C21H19ClFN5O5S — CID 171573560
5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N,N-dimethyl-1,3,4-oxadiazole-2-carboxamide (PubChem CID 171573560) has the molecular formula C21H19ClFN5O5S and a molecular weight of 507.93 g/mol. Its IUPAC name is 5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N,N-dimethyl-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N,N-dimethyl-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 171573560 |
| Molecular Formula | C21H19ClFN5O5S |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 5-[(3R)-3-amino-5-[(4-chlorophenyl)methyl]-8-fluoro-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-7-yl]-N,N-dimethyl-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CN(C)C(=O)c1nnc(-c2cc3c(cc2F)S(=O)(=O)C[C@H](N)C(=O)N3Cc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C21H19ClFN5O5S/c1-27(2)21(30)19-26-25-18(33-19)13-7-16-17(8-14(13)23)34(31,32)10-15(24)20(29)28(16)9-11-3-5-12(22)6-4-11/h3-8,15H,9-10,24H2,1-2H3/t15-/m0/s1 |
| InChIKey | LYNQDQBEGXICGD-HNNXBMFYSA-N |
| XLogP | 1.88 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |