About bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine
bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine (PubChem CID 171575301) has the molecular formula C26H30N8Os
and a molecular weight of 644.81 g/mol. Its IUPAC name is bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine.
Molecular Properties
| Compound Name | bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine |
| PubChem CID | 171575301 |
| Molecular Formula | C26H30N8Os |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine |
| SMILES | Cn1ccnc1.Cn1ccnc1.[Os].c1ccc(CN(Cc2ccccn2)Cc2ccccn2)nc1 |
| InChI | InChI=1S/C18H18N4.2C4H6N2.Os/c1-4-10-19-16(7-1)13-22(14-17-8-2-5-11-20-17)15-18-9-3-6-12-21-18;2*1-6-3-2-5-4-6;/h1-12H,13-15H2;2*2-4H,1H3; |
| InChIKey | GNFDVEQWSRGMSD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine?
The IUPAC name of bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine (CID 171575301) is bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine.
What is the SMILES notation for bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine?
The canonical SMILES for bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine is Cn1ccnc1.Cn1ccnc1.[Os].c1ccc(CN(Cc2ccccn2)Cc2ccccn2)nc1.
What is the InChIKey of bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine?
The InChIKey is GNFDVEQWSRGMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4.2C4H6N2.Os/c1-4-10-19-16(7-1)13-22(14-17-8-2-5-11-20-17)15-18-9-3-6-12-21-18;2*1-6-3-2-5-4-6;/h1-12H,13-15H2;2*2-4H,1H3;.
What are the key properties of bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine?
bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine has a molecular weight of 644.81 g/mol, XLogP of 3.91, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-methylimidazole);osmium;1-pyridin-2-yl-N,N-bis(pyridin-2-ylmethyl)methanamine is sourced from PubChem (CID 171575301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).