About 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]
7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] (PubChem CID 171575376) has the molecular formula C16H22ClN
and a molecular weight of 263.81 g/mol. Its IUPAC name is 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane].
Molecular Properties
| Compound Name | 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] |
| PubChem CID | 171575376 |
| Molecular Formula | C16H22ClN |
| Molecular Weight | 263.81 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] |
| SMILES | CN1Cc2cc(C(C)(C)C)cc(Cl)c2C2(CC2)C1 |
| InChI | InChI=1S/C16H22ClN/c1-15(2,3)12-7-11-9-18(4)10-16(5-6-16)14(11)13(17)8-12/h7-8H,5-6,9-10H2,1-4H3 |
| InChIKey | YJFWCIOTQCVUIQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]?
The IUPAC name of 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] (CID 171575376) is 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane].
What is the SMILES notation for 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]?
The canonical SMILES for 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] is CN1Cc2cc(C(C)(C)C)cc(Cl)c2C2(CC2)C1.
What is the InChIKey of 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]?
The InChIKey is YJFWCIOTQCVUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClN/c1-15(2,3)12-7-11-9-18(4)10-16(5-6-16)14(11)13(17)8-12/h7-8H,5-6,9-10H2,1-4H3.
What are the key properties of 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane]?
7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] has a molecular weight of 263.81 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-5-chloro-2-methylspiro[1,3-dihydroisoquinoline-4,1'-cyclopropane] is sourced from PubChem (CID 171575376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).