C16H8F4N2O4S — CID 171575775
5-[[(4R,5R,6S)-3,3,5,6-tetrafluoro-4-hydroxy-2,2-dioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl]oxy]pyridine-3-carbonitrile (PubChem CID 171575775) has the molecular formula C16H8F4N2O4S and a molecular weight of 400.31 g/mol. Its IUPAC name is 5-[[(4R,5R,6S)-3,3,5,6-tetrafluoro-4-hydroxy-2,2-dioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl]oxy]pyridine-3-carbonitrile.
| Compound Name | 5-[[(4R,5R,6S)-3,3,5,6-tetrafluoro-4-hydroxy-2,2-dioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl]oxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171575775 |
| Molecular Formula | C16H8F4N2O4S |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 5-[[(4R,5R,6S)-3,3,5,6-tetrafluoro-4-hydroxy-2,2-dioxo-2λ6-thiatricyclo[5.3.1.04,11]undeca-1(11),7,9-trien-8-yl]oxy]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(Oc2ccc3c4c2[C@H](F)[C@H](F)[C@@]4(O)C(F)(F)S3(=O)=O)c1 |
| InChI | InChI=1S/C16H8F4N2O4S/c17-13-11-9(26-8-3-7(4-21)5-22-6-8)1-2-10-12(11)15(23,14(13)18)16(19,20)27(10,24)25/h1-3,5-6,13-14,23H/t13-,14-,15+/m0/s1 |
| InChIKey | NKAACNKIKYHOHW-SOUVJXGZSA-N |
| XLogP | 2.68 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |