About (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one
(2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one (PubChem CID 171576046) has the molecular formula C15H27F2NO
and a molecular weight of 275.38 g/mol. Its IUPAC name is (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one.
Molecular Properties
| Compound Name | (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one |
| PubChem CID | 171576046 |
| Molecular Formula | C15H27F2NO |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one |
| SMILES | CC(C)N[C@@H](CC1CCC(F)(F)CC1)C(=O)C(C)C |
| InChI | InChI=1S/C15H27F2NO/c1-10(2)14(19)13(18-11(3)4)9-12-5-7-15(16,17)8-6-12/h10-13,18H,5-9H2,1-4H3/t13-/m0/s1 |
| InChIKey | MWOUXTCINQFYIY-ZDUSSCGKSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one?
The IUPAC name of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one (CID 171576046) is (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one.
What is the SMILES notation for (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one?
The canonical SMILES for (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one is CC(C)N[C@@H](CC1CCC(F)(F)CC1)C(=O)C(C)C.
What is the InChIKey of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one?
The InChIKey is MWOUXTCINQFYIY-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H27F2NO/c1-10(2)14(19)13(18-11(3)4)9-12-5-7-15(16,17)8-6-12/h10-13,18H,5-9H2,1-4H3/t13-/m0/s1.
What are the key properties of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one?
(2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one has a molecular weight of 275.38 g/mol, XLogP of 3.79, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-(propan-2-ylamino)pentan-3-one is sourced from PubChem (CID 171576046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).