About (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one
(2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one (PubChem CID 171576079) has the molecular formula C18H33F2NO
and a molecular weight of 317.46 g/mol. Its IUPAC name is (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one.
Molecular Properties
| Compound Name | (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one |
| PubChem CID | 171576079 |
| Molecular Formula | C18H33F2NO |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one |
| SMILES | CCCN(C(C)C)[C@@H](CC1CCC(F)(F)CC1)C(=O)C(C)C |
| InChI | InChI=1S/C18H33F2NO/c1-6-11-21(14(4)5)16(17(22)13(2)3)12-15-7-9-18(19,20)10-8-15/h13-16H,6-12H2,1-5H3/t16-/m0/s1 |
| InChIKey | RMZYFHQQCQQAIJ-INIZCTEOSA-N |
| XLogP | 4.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one?
The IUPAC name of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one (CID 171576079) is (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one.
What is the SMILES notation for (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one?
The canonical SMILES for (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one is CCCN(C(C)C)[C@@H](CC1CCC(F)(F)CC1)C(=O)C(C)C.
What is the InChIKey of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one?
The InChIKey is RMZYFHQQCQQAIJ-INIZCTEOSA-N. The full InChI is InChI=1S/C18H33F2NO/c1-6-11-21(14(4)5)16(17(22)13(2)3)12-15-7-9-18(19,20)10-8-15/h13-16H,6-12H2,1-5H3/t16-/m0/s1.
What are the key properties of (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one?
(2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one has a molecular weight of 317.46 g/mol, XLogP of 4.92, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(4,4-difluorocyclohexyl)-4-methyl-2-[propan-2-yl(propyl)amino]pentan-3-one is sourced from PubChem (CID 171576079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).