About N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide
N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide (PubChem CID 171577249) has the molecular formula C24H37NO
and a molecular weight of 355.57 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide |
| PubChem CID | 171577249 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)C14CC5CC(CC(C)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C24H37NO/c1-20-5-16-4-17(6-20)10-23(9-16,13-20)19(26)25-24-11-18-7-21(2,14-24)12-22(3,8-18)15-24/h16-18H,4-15H2,1-3H3,(H,25,26) |
| InChIKey | XLPFAWCYYJDSFY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide?
The IUPAC name of N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide (CID 171577249) is N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide.
What is the SMILES notation for N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide?
The canonical SMILES for N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide is CC12CC3CC(C)(C1)CC(NC(=O)C14CC5CC(CC(C)(C5)C1)C4)(C3)C2.
What is the InChIKey of N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide?
The InChIKey is XLPFAWCYYJDSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H37NO/c1-20-5-16-4-17(6-20)10-23(9-16,13-20)19(26)25-24-11-18-7-21(2,14-24)12-22(3,8-18)15-24/h16-18H,4-15H2,1-3H3,(H,25,26).
What are the key properties of N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide?
N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide has a molecular weight of 355.57 g/mol, XLogP of 5.46, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethyl-1-adamantyl)-3-methyladamantane-1-carboxamide is sourced from PubChem (CID 171577249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).