C12H9F5N2O — CID 171579005
N-[1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethylidene]hydroxylamine (PubChem CID 171579005) has the molecular formula C12H9F5N2O and a molecular weight of 292.21 g/mol. Its IUPAC name is N-[1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethylidene]hydroxylamine.
| Compound Name | N-[1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethylidene]hydroxylamine |
|---|---|
| PubChem CID | 171579005 |
| Molecular Formula | C12H9F5N2O |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethylidene]hydroxylamine |
| SMILES | Cc1c(C(=NO)C(F)(F)F)n(C)c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C12H9F5N2O/c1-5-7-3-6(13)4-8(14)10(7)19(2)9(5)11(18-20)12(15,16)17/h3-4,20H,1-2H3 |
| InChIKey | IDARYMDGXQTGOY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|