C28H21N4OPt- — CID 171580171
5-methyl-2-[10-(5-methyl-2-pyridinyl)-1,5-dihydrophenazin-1-id-2-yl]quinolin-8-ol;platinum (PubChem CID 171580171) has the molecular formula C28H21N4OPt- and a molecular weight of 624.58 g/mol. Its IUPAC name is 5-methyl-2-[10-(5-methyl-2-pyridinyl)-1,5-dihydrophenazin-1-id-2-yl]quinolin-8-ol;platinum.
| Compound Name | 5-methyl-2-[10-(5-methyl-2-pyridinyl)-1,5-dihydrophenazin-1-id-2-yl]quinolin-8-ol;platinum |
|---|---|
| PubChem CID | 171580171 |
| Molecular Formula | C28H21N4OPt- |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 5-methyl-2-[10-(5-methyl-2-pyridinyl)-1,5-dihydrophenazin-1-id-2-yl]quinolin-8-ol;platinum |
| SMILES | Cc1ccc(N2c3[c-]c(-c4ccc5c(C)ccc(O)c5n4)ccc3Nc3ccccc32)nc1.[Pt] |
| InChI | InChI=1S/C28H21N4O.Pt/c1-17-7-14-27(29-16-17)32-24-6-4-3-5-22(24)30-23-11-9-19(15-25(23)32)21-12-10-20-18(2)8-13-26(33)28(20)31-21;/h3-14,16,30,33H,1-2H3;/q-1; |
| InChIKey | RLYNLNWQSXAQJS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|