C42H48IrNO2S- — CID 171581649
12-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-17-thia-13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 171581649) has the molecular formula C42H48IrNO2S- and a molecular weight of 823.13 g/mol. Its IUPAC name is 12-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-17-thia-13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 12-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-17-thia-13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 171581649 |
| Molecular Formula | C42H48IrNO2S- |
| Molecular Weight | 823.13 g/mol |
| Exact Mass | 823.30 |
| IUPAC Name | 12-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-17-thia-13-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11(16),12,14-heptaene;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)c1cc(-c2nccc3sc4c(c23)CCc2ccccc2-4)[c-]c2ccccc12.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C29H24NS.C13H24O2.Ir/c1-29(2,3)24-17-20(16-19-9-5-6-10-21(19)24)27-26-23-13-12-18-8-4-7-11-22(18)28(23)31-25(26)14-15-30-27;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h4-11,14-15,17H,12-13H2,1-3H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | JHEHKRHQCPYSLF-DZTQYQPZSA-N |
| XLogP | 11.85 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.13 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|