About imidazo[4,5-b]pyrazine-3-sulfinate
imidazo[4,5-b]pyrazine-3-sulfinate (PubChem CID 171581840) has the molecular formula C5H3N4O2S-
and a molecular weight of 183.17 g/mol. Its IUPAC name is imidazo[4,5-b]pyrazine-3-sulfinate.
Molecular Properties
| Compound Name | imidazo[4,5-b]pyrazine-3-sulfinate |
| PubChem CID | 171581840 |
| Molecular Formula | C5H3N4O2S- |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | imidazo[4,5-b]pyrazine-3-sulfinate |
| SMILES | O=S([O-])n1cnc2nccnc21 |
| InChI | InChI=1S/C5H4N4O2S/c10-12(11)9-3-8-4-5(9)7-2-1-6-4/h1-3H,(H,10,11)/p-1 |
| InChIKey | BQCCOQMEYBBVRC-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 83.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze imidazo[4,5-b]pyrazine-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-b]pyrazine-3-sulfinate?
The IUPAC name of imidazo[4,5-b]pyrazine-3-sulfinate (CID 171581840) is imidazo[4,5-b]pyrazine-3-sulfinate.
What is the SMILES notation for imidazo[4,5-b]pyrazine-3-sulfinate?
The canonical SMILES for imidazo[4,5-b]pyrazine-3-sulfinate is O=S([O-])n1cnc2nccnc21.
What is the InChIKey of imidazo[4,5-b]pyrazine-3-sulfinate?
The InChIKey is BQCCOQMEYBBVRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N4O2S/c10-12(11)9-3-8-4-5(9)7-2-1-6-4/h1-3H,(H,10,11)/p-1.
What are the key properties of imidazo[4,5-b]pyrazine-3-sulfinate?
imidazo[4,5-b]pyrazine-3-sulfinate has a molecular weight of 183.17 g/mol, XLogP of -0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-b]pyrazine-3-sulfinate is sourced from PubChem (CID 171581840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).