C12H14O2 — CID 171581931
4,4-dideuterio-2-phenylmethoxycyclopentan-1-one (PubChem CID 171581931) has the molecular formula C12H14O2 and a molecular weight of 192.25 g/mol. Its IUPAC name is 4,4-dideuterio-2-phenylmethoxycyclopentan-1-one.
| Compound Name | 4,4-dideuterio-2-phenylmethoxycyclopentan-1-one |
|---|---|
| PubChem CID | 171581931 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 4,4-dideuterio-2-phenylmethoxycyclopentan-1-one |
| SMILES | [2H]C1([2H])CC(=O)C(OCc2ccccc2)C1 |
| InChI | InChI=1S/C12H14O2/c13-11-7-4-8-12(11)14-9-10-5-2-1-3-6-10/h1-3,5-6,12H,4,7-9H2/i4D2 |
| InChIKey | WYNUTNLIODWGDR-APZFVMQVSA-N |
| XLogP | 2.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |