C6H13FN2O2S — CID 171582016
(3S,4R)-3-fluoro-1-methylsulfonylpiperidin-4-amine (PubChem CID 171582016) has the molecular formula C6H13FN2O2S and a molecular weight of 196.25 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-1-methylsulfonylpiperidin-4-amine.
| Compound Name | (3S,4R)-3-fluoro-1-methylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 171582016 |
| Molecular Formula | C6H13FN2O2S |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (3S,4R)-3-fluoro-1-methylsulfonylpiperidin-4-amine |
| SMILES | CS(=O)(=O)N1CC[C@@H](N)[C@@H](F)C1 |
| InChI | InChI=1S/C6H13FN2O2S/c1-12(10,11)9-3-2-6(8)5(7)4-9/h5-6H,2-4,8H2,1H3/t5-,6+/m0/s1 |
| InChIKey | OMLDKOMECAGHJA-NTSWFWBYSA-N |
| XLogP | -0.68 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |