C23H26F3N5O6S — CID 171582282
tert-butyl (2S)-2-(cyanomethyl)-4-[5-(trifluoromethylsulfonyloxy)-3,4-dihydro-2H-pyrano[2,3-f]quinazolin-10-yl]piperazine-1-carboxylate (PubChem CID 171582282) has the molecular formula C23H26F3N5O6S and a molecular weight of 557.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-(cyanomethyl)-4-[5-(trifluoromethylsulfonyloxy)-3,4-dihydro-2H-pyrano[2,3-f]quinazolin-10-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(cyanomethyl)-4-[5-(trifluoromethylsulfonyloxy)-3,4-dihydro-2H-pyrano[2,3-f]quinazolin-10-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 171582282 |
| Molecular Formula | C23H26F3N5O6S |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | tert-butyl (2S)-2-(cyanomethyl)-4-[5-(trifluoromethylsulfonyloxy)-3,4-dihydro-2H-pyrano[2,3-f]quinazolin-10-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncnc3cc(OS(=O)(=O)C(F)(F)F)c4c(c23)OCCC4)C[C@@H]1CC#N |
| InChI | InChI=1S/C23H26F3N5O6S/c1-22(2,3)36-21(32)31-9-8-30(12-14(31)6-7-27)20-18-16(28-13-29-20)11-17(15-5-4-10-35-19(15)18)37-38(33,34)23(24,25)26/h11,13-14H,4-6,8-10,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | NIOOQMIAIYGXQM-AWEZNQCLSA-N |
| XLogP | 3.52 |
| TPSA | 134.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|