About N,N'-dimethyl-N"-propan-2-ylmethanetriamine
N,N'-dimethyl-N"-propan-2-ylmethanetriamine (PubChem CID 171585819) has the molecular formula C6H17N3
and a molecular weight of 131.22 g/mol. Its IUPAC name is N,N'-dimethyl-N"-propan-2-ylmethanetriamine.
Molecular Properties
| Compound Name | N,N'-dimethyl-N"-propan-2-ylmethanetriamine |
| PubChem CID | 171585819 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | N,N'-dimethyl-N"-propan-2-ylmethanetriamine |
| SMILES | CNC(NC)NC(C)C |
| InChI | InChI=1S/C6H17N3/c1-5(2)9-6(7-3)8-4/h5-9H,1-4H3 |
| InChIKey | RKRBBYGVGWJPTQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dimethyl-N"-propan-2-ylmethanetriamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethyl-N"-propan-2-ylmethanetriamine?
The IUPAC name of N,N'-dimethyl-N"-propan-2-ylmethanetriamine (CID 171585819) is N,N'-dimethyl-N"-propan-2-ylmethanetriamine.
What is the SMILES notation for N,N'-dimethyl-N"-propan-2-ylmethanetriamine?
The canonical SMILES for N,N'-dimethyl-N"-propan-2-ylmethanetriamine is CNC(NC)NC(C)C.
What is the InChIKey of N,N'-dimethyl-N"-propan-2-ylmethanetriamine?
The InChIKey is RKRBBYGVGWJPTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N3/c1-5(2)9-6(7-3)8-4/h5-9H,1-4H3.
What are the key properties of N,N'-dimethyl-N"-propan-2-ylmethanetriamine?
N,N'-dimethyl-N"-propan-2-ylmethanetriamine has a molecular weight of 131.22 g/mol, XLogP of -0.29, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethyl-N"-propan-2-ylmethanetriamine is sourced from PubChem (CID 171585819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).