C27H34F2N2O4 — CID 171586500
2-[4-(2,6-dibutoxy-3-pyridinyl)-3,5-difluoroanilino]spiro[3.3]heptane-6-carboxylic acid (PubChem CID 171586500) has the molecular formula C27H34F2N2O4 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[4-(2,6-dibutoxy-3-pyridinyl)-3,5-difluoroanilino]spiro[3.3]heptane-6-carboxylic acid.
| Compound Name | 2-[4-(2,6-dibutoxy-3-pyridinyl)-3,5-difluoroanilino]spiro[3.3]heptane-6-carboxylic acid |
|---|---|
| PubChem CID | 171586500 |
| Molecular Formula | C27H34F2N2O4 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-[4-(2,6-dibutoxy-3-pyridinyl)-3,5-difluoroanilino]spiro[3.3]heptane-6-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2c(F)cc(NC3CC4(C3)CC(C(=O)O)C4)cc2F)c(OCCCC)n1 |
| InChI | InChI=1S/C27H34F2N2O4/c1-3-5-9-34-23-8-7-20(25(31-23)35-10-6-4-2)24-21(28)11-18(12-22(24)29)30-19-15-27(16-19)13-17(14-27)26(32)33/h7-8,11-12,17,19,30H,3-6,9-10,13-16H2,1-2H3,(H,32,33) |
| InChIKey | ACYSEEKMLDTJBP-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|