About [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol
[(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol (PubChem CID 171587567) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol |
| PubChem CID | 171587567 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol |
| SMILES | CC(C)N1C[C@H](C)N(C(C)C)C[C@H]1CO |
| InChI | InChI=1S/C12H26N2O/c1-9(2)13-7-12(8-15)14(10(3)4)6-11(13)5/h9-12,15H,6-8H2,1-5H3/t11-,12-/m0/s1 |
| InChIKey | HHBZUFRPMIMCIZ-RYUDHWBXSA-N |
| XLogP | 1.17 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol?
The IUPAC name of [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol (CID 171587567) is [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol.
What is the SMILES notation for [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol?
The canonical SMILES for [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol is CC(C)N1C[C@H](C)N(C(C)C)C[C@H]1CO.
What is the InChIKey of [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol?
The InChIKey is HHBZUFRPMIMCIZ-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H26N2O/c1-9(2)13-7-12(8-15)14(10(3)4)6-11(13)5/h9-12,15H,6-8H2,1-5H3/t11-,12-/m0/s1.
What are the key properties of [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol?
[(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol has a molecular weight of 214.35 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5S)-5-methyl-1,4-di(propan-2-yl)piperazin-2-yl]methanol is sourced from PubChem (CID 171587567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).