About 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine
5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine (PubChem CID 171587786) has the molecular formula C11H16F3N3
and a molecular weight of 247.26 g/mol. Its IUPAC name is 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine.
Molecular Properties
| Compound Name | 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine |
| PubChem CID | 171587786 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine |
| SMILES | CC(C)c1nnc(C(F)(F)F)nc1C(C)(C)C |
| InChI | InChI=1S/C11H16F3N3/c1-6(2)7-8(10(3,4)5)15-9(17-16-7)11(12,13)14/h6H,1-5H3 |
| InChIKey | HPMQQTUWEDXRHM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine?
The IUPAC name of 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine (CID 171587786) is 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine.
What is the SMILES notation for 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine?
The canonical SMILES for 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine is CC(C)c1nnc(C(F)(F)F)nc1C(C)(C)C.
What is the InChIKey of 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine?
The InChIKey is HPMQQTUWEDXRHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3/c1-6(2)7-8(10(3,4)5)15-9(17-16-7)11(12,13)14/h6H,1-5H3.
What are the key properties of 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine?
5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine has a molecular weight of 247.26 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-6-propan-2-yl-3-(trifluoromethyl)-1,2,4-triazine is sourced from PubChem (CID 171587786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).