C41H25N5 — CID 171588857
4-[10-[4-(4-phenyl-6-pyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenanthren-9-yl]benzonitrile (PubChem CID 171588857) has the molecular formula C41H25N5 and a molecular weight of 587.69 g/mol. Its IUPAC name is 4-[10-[4-(4-phenyl-6-pyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenanthren-9-yl]benzonitrile.
| Compound Name | 4-[10-[4-(4-phenyl-6-pyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenanthren-9-yl]benzonitrile |
|---|---|
| PubChem CID | 171588857 |
| Molecular Formula | C41H25N5 |
| Molecular Weight | 587.69 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 4-[10-[4-(4-phenyl-6-pyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenanthren-9-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(-c3ccc(-c4nc(-c5ccccc5)nc(-c5cccnc5)n4)cc3)c3ccccc3c3ccccc23)cc1 |
| InChI | InChI=1S/C41H25N5/c42-25-27-16-18-28(19-17-27)37-35-14-6-4-12-33(35)34-13-5-7-15-36(34)38(37)29-20-22-31(23-21-29)40-44-39(30-9-2-1-3-10-30)45-41(46-40)32-11-8-24-43-26-32/h1-24,26H |
| InChIKey | VRDBLYQBYKTXSG-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.69 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|