About (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide
(4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide (PubChem CID 171590273) has the molecular formula C7H15F2NO2S
and a molecular weight of 215.26 g/mol. Its IUPAC name is (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide.
Molecular Properties
| Compound Name | (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide |
| PubChem CID | 171590273 |
| Molecular Formula | C7H15F2NO2S |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide |
| SMILES | CC(C)(C[C@@H](CO)C(F)F)S(N)=O |
| InChI | InChI=1S/C7H15F2NO2S/c1-7(2,13(10)12)3-5(4-11)6(8)9/h5-6,11H,3-4,10H2,1-2H3/t5-,13?/m0/s1 |
| InChIKey | YUEMUIWYGFFRQZ-UOVNDPRFSA-N |
| XLogP | 0.65 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide?
The IUPAC name of (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide (CID 171590273) is (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide.
What is the SMILES notation for (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide?
The canonical SMILES for (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide is CC(C)(C[C@@H](CO)C(F)F)S(N)=O.
What is the InChIKey of (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide?
The InChIKey is YUEMUIWYGFFRQZ-UOVNDPRFSA-N. The full InChI is InChI=1S/C7H15F2NO2S/c1-7(2,13(10)12)3-5(4-11)6(8)9/h5-6,11H,3-4,10H2,1-2H3/t5-,13?/m0/s1.
What are the key properties of (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide?
(4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide has a molecular weight of 215.26 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,5-difluoro-4-(hydroxymethyl)-2-methylpentane-2-sulfinamide is sourced from PubChem (CID 171590273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).