About [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate
[(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate (PubChem CID 171590277) has the molecular formula C12H23F2NO3S
and a molecular weight of 299.38 g/mol. Its IUPAC name is [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate |
| PubChem CID | 171590277 |
| Molecular Formula | C12H23F2NO3S |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H](N[S@@](=O)C(C)(C)C)C(F)F |
| InChI | InChI=1S/C12H23F2NO3S/c1-11(2,3)10(16)18-7-8(9(13)14)15-19(17)12(4,5)6/h8-9,15H,7H2,1-6H3/t8-,19-/m0/s1 |
| InChIKey | RIUPBRWEIBCLAC-RLBGWGEZSA-N |
| XLogP | 2.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate?
The IUPAC name of [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate (CID 171590277) is [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC[C@H](N[S@@](=O)C(C)(C)C)C(F)F.
What is the InChIKey of [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate?
The InChIKey is RIUPBRWEIBCLAC-RLBGWGEZSA-N. The full InChI is InChI=1S/C12H23F2NO3S/c1-11(2,3)10(16)18-7-8(9(13)14)15-19(17)12(4,5)6/h8-9,15H,7H2,1-6H3/t8-,19-/m0/s1.
What are the key properties of [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate?
[(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate has a molecular weight of 299.38 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[[(S)-tert-butylsulfinyl]amino]-3,3-difluoropropyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 171590277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).