C19H22Cl2N2 — CID 17159064
1-benzyl-N-[(2,4-dichlorophenyl)methyl]piperidin-4-amine (PubChem CID 17159064) has the molecular formula C19H22Cl2N2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 1-benzyl-N-[(2,4-dichlorophenyl)methyl]piperidin-4-amine.
| Compound Name | 1-benzyl-N-[(2,4-dichlorophenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 17159064 |
| Molecular Formula | C19H22Cl2N2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-benzyl-N-[(2,4-dichlorophenyl)methyl]piperidin-4-amine |
| SMILES | Clc1ccc(CNC2CCN(Cc3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2/c20-17-7-6-16(19(21)12-17)13-22-18-8-10-23(11-9-18)14-15-4-2-1-3-5-15/h1-7,12,18,22H,8-11,13-14H2 |
| InChIKey | SNVYJMWDDMTGPN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |