C13H22FN — CID 171590798
8-[(E)-3,3-dimethylbut-1-enyl]-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 171590798) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is 8-[(E)-3,3-dimethylbut-1-enyl]-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-[(E)-3,3-dimethylbut-1-enyl]-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 171590798 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 8-[(E)-3,3-dimethylbut-1-enyl]-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC(C)(C)/C=C/C12CCCN1CC(F)C2 |
| InChI | InChI=1S/C13H22FN/c1-12(2,3)6-7-13-5-4-8-15(13)10-11(14)9-13/h6-7,11H,4-5,8-10H2,1-3H3/b7-6+ |
| InChIKey | FLMIBJKQNNMQPW-VOTSOKGWSA-N |
| XLogP | 3.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|