C14H24FN — CID 171590803
(1S,4R)-3-[(E)-3,3-dimethylbut-1-enyl]-2-(2-fluoroethyl)-2-azabicyclo[2.2.1]heptane (PubChem CID 171590803) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is (1S,4R)-3-[(E)-3,3-dimethylbut-1-enyl]-2-(2-fluoroethyl)-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1S,4R)-3-[(E)-3,3-dimethylbut-1-enyl]-2-(2-fluoroethyl)-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 171590803 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (1S,4R)-3-[(E)-3,3-dimethylbut-1-enyl]-2-(2-fluoroethyl)-2-azabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)/C=C/C1[C@@H]2CC[C@@H](C2)N1CCF |
| InChI | InChI=1S/C14H24FN/c1-14(2,3)7-6-13-11-4-5-12(10-11)16(13)9-8-15/h6-7,11-13H,4-5,8-10H2,1-3H3/b7-6+/t11-,12+,13?/m1/s1 |
| InChIKey | IFWYTPBDDSVZDU-XAKHAUDUSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|