C34H37FN6O2 — CID 171590863
4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethylnaphthalen-2-ol (PubChem CID 171590863) has the molecular formula C34H37FN6O2 and a molecular weight of 580.71 g/mol. Its IUPAC name is 4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethylnaphthalen-2-ol.
| Compound Name | 4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethylnaphthalen-2-ol |
|---|---|
| PubChem CID | 171590863 |
| Molecular Formula | C34H37FN6O2 |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(6-methylidene-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methoxy]pyrido[4,3-d]pyrimidin-7-yl]-5-ethylnaphthalen-2-ol |
| SMILES | C=C1CN2CCCC2(COc2nc(N3C[C@H]4CC[C@@H](C3)N4)c3cnc(-c4cc(O)cc5cccc(CC)c45)c(F)c3n2)C1 |
| InChI | InChI=1S/C34H37FN6O2/c1-3-21-6-4-7-22-12-25(42)13-26(28(21)22)30-29(35)31-27(15-36-30)32(40-17-23-8-9-24(18-40)37-23)39-33(38-31)43-19-34-10-5-11-41(34)16-20(2)14-34/h4,6-7,12-13,15,23-24,37,42H,2-3,5,8-11,14,16-19H2,1H3/t23-,24+,34? |
| InChIKey | NOEVFWIDCNNXBH-CPYIJSPHSA-N |
| XLogP | 5.37 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|