C34H32F2N6O — CID 171590884
4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(E)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethenyl]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 171590884) has the molecular formula C34H32F2N6O and a molecular weight of 578.67 g/mol. Its IUPAC name is 4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(E)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethenyl]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(E)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethenyl]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 171590884 |
| Molecular Formula | C34H32F2N6O |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 4-[4-[(1R,5S)-3,8-diazabicyclo[3.2.1]octan-3-yl]-8-fluoro-2-[(E)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethenyl]pyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(N5C[C@H]6CC[C@@H](C5)N6)nc(/C=C/C56CCCN5CCC6)nc4c3F)c12 |
| InChI | InChI=1S/C34H32F2N6O/c1-2-24-27(35)8-5-20-15-23(43)16-25(29(20)24)31-30(36)32-26(17-37-31)33(41-18-21-6-7-22(19-41)38-21)40-28(39-32)9-12-34-10-3-13-42(34)14-4-11-34/h1,5,8-9,12,15-17,21-22,38,43H,3-4,6-7,10-11,13-14,18-19H2/b12-9+/t21-,22+ |
| InChIKey | UDWVBNAGHAWTLY-JLGWHQMESA-N |
| XLogP | 5.39 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|