C61H37N5O3 — CID 171591026
2-[4-(9-oxo-10-phenyl-10H-phenanthren-3-yl)-6-(6-oxo-5-phenylphenanthridin-2-yl)-1,3,5-triazin-2-yl]-5-phenylphenanthridin-6-one (PubChem CID 171591026) has the molecular formula C61H37N5O3 and a molecular weight of 888.00 g/mol. Its IUPAC name is 2-[4-(9-oxo-10-phenyl-10H-phenanthren-3-yl)-6-(6-oxo-5-phenylphenanthridin-2-yl)-1,3,5-triazin-2-yl]-5-phenylphenanthridin-6-one.
| Compound Name | 2-[4-(9-oxo-10-phenyl-10H-phenanthren-3-yl)-6-(6-oxo-5-phenylphenanthridin-2-yl)-1,3,5-triazin-2-yl]-5-phenylphenanthridin-6-one |
|---|---|
| PubChem CID | 171591026 |
| Molecular Formula | C61H37N5O3 |
| Molecular Weight | 888.00 g/mol |
| Exact Mass | 887.29 |
| IUPAC Name | 2-[4-(9-oxo-10-phenyl-10H-phenanthren-3-yl)-6-(6-oxo-5-phenylphenanthridin-2-yl)-1,3,5-triazin-2-yl]-5-phenylphenanthridin-6-one |
| SMILES | O=C1c2ccccc2-c2cc(-c3nc(-c4ccc5c(c4)c4ccccc4c(=O)n5-c4ccccc4)nc(-c4ccc5c(c4)c4ccccc4c(=O)n5-c4ccccc4)n3)ccc2C1c1ccccc1 |
| InChI | InChI=1S/C61H37N5O3/c67-56-47-25-13-10-22-43(47)50-34-38(28-31-46(50)55(56)37-16-4-1-5-17-37)57-62-58(39-29-32-53-51(35-39)44-23-11-14-26-48(44)60(68)65(53)41-18-6-2-7-19-41)64-59(63-57)40-30-33-54-52(36-40)45-24-12-15-27-49(45)61(69)66(54)42-20-8-3-9-21-42/h1-36,55H |
| InChIKey | XOSGIPHTZDDJCH-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 99.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.00 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|