About 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate
2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate (PubChem CID 171591337) has the molecular formula C9H5Cl2F2O2-
and a molecular weight of 254.04 g/mol. Its IUPAC name is 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate |
| PubChem CID | 171591337 |
| Molecular Formula | C9H5Cl2F2O2- |
| Molecular Weight | 254.04 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate |
| SMILES | Cc1ccc(Cl)c(Cl)c1C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C9H6Cl2F2O2/c1-4-2-3-5(10)7(11)6(4)9(12,13)8(14)15/h2-3H,1H3,(H,14,15)/p-1 |
| InChIKey | YXMBHPXYQLNASH-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.04 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate?
The IUPAC name of 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate (CID 171591337) is 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate.
What is the SMILES notation for 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate?
The canonical SMILES for 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate is Cc1ccc(Cl)c(Cl)c1C(F)(F)C(=O)[O-].
What is the InChIKey of 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate?
The InChIKey is YXMBHPXYQLNASH-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6Cl2F2O2/c1-4-2-3-5(10)7(11)6(4)9(12,13)8(14)15/h2-3H,1H3,(H,14,15)/p-1.
What are the key properties of 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate?
2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate has a molecular weight of 254.04 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichloro-6-methylphenyl)-2,2-difluoroacetate is sourced from PubChem (CID 171591337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).