C16F4N4O4 — CID 171592110
2,3,9,10-tetrafluoro-13-isocyano-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-6-carbonitrile (PubChem CID 171592110) has the molecular formula C16F4N4O4 and a molecular weight of 388.19 g/mol. Its IUPAC name is 2,3,9,10-tetrafluoro-13-isocyano-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-6-carbonitrile.
| Compound Name | 2,3,9,10-tetrafluoro-13-isocyano-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-6-carbonitrile |
|---|---|
| PubChem CID | 171592110 |
| Molecular Formula | C16F4N4O4 |
| Molecular Weight | 388.19 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 2,3,9,10-tetrafluoro-13-isocyano-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-6-carbonitrile |
| SMILES | [C-]#[N+]N1C(=O)c2c(F)c(F)c3c4c(c(F)c(F)c(c24)C1=O)C(=O)N(C#N)C3=O |
| InChI | InChI=1S/C16F4N4O4/c1-22-24-15(27)7-4-3-5(9(17)11(7)19)13(25)23(2-21)14(26)6(3)10(18)12(20)8(4)16(24)28 |
| InChIKey | FRMHNNQOXMCACG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|