C26H12F2N2S4 — CID 171592244
6,13-bis(3-fluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrathione (PubChem CID 171592244) has the molecular formula C26H12F2N2S4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 6,13-bis(3-fluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrathione.
| Compound Name | 6,13-bis(3-fluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrathione |
|---|---|
| PubChem CID | 171592244 |
| Molecular Formula | C26H12F2N2S4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | 6,13-bis(3-fluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrathione |
| SMILES | Fc1cccc(N2C(=S)c3ccc4c5c(ccc(c35)C2=S)C(=S)N(c2cccc(F)c2)C4=S)c1 |
| InChI | InChI=1S/C26H12F2N2S4/c27-13-3-1-5-15(11-13)29-23(31)17-7-9-19-22-20(10-8-18(21(17)22)24(29)32)26(34)30(25(19)33)16-6-2-4-14(28)12-16/h1-12H |
| InChIKey | ZDQCCVFFUHFBSD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|