C14Cl2F4N2O4 — CID 171592251
6,13-dichloro-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 171592251) has the molecular formula C14Cl2F4N2O4 and a molecular weight of 407.06 g/mol. Its IUPAC name is 6,13-dichloro-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-dichloro-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 171592251 |
| Molecular Formula | C14Cl2F4N2O4 |
| Molecular Weight | 407.06 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 6,13-dichloro-2,3,9,10-tetrafluoro-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1c2c(F)c(F)c3c4c(c(F)c(F)c(c24)C(=O)N1Cl)C(=O)N(Cl)C3=O |
| InChI | InChI=1S/C14Cl2F4N2O4/c15-21-11(23)3-1-2-5(9(19)7(3)17)13(25)22(16)14(26)6(2)10(20)8(18)4(1)12(21)24 |
| InChIKey | YXELQTRQHWGANP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.06 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|