C19H22Cl2N2O3S — CID 171593445
N-[2-[cyclopropyloxymethyl(methyl)amino]-1-(3,4-dichlorophenyl)ethyl]benzenesulfonamide (PubChem CID 171593445) has the molecular formula C19H22Cl2N2O3S and a molecular weight of 429.37 g/mol. Its IUPAC name is N-[2-[cyclopropyloxymethyl(methyl)amino]-1-(3,4-dichlorophenyl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-[cyclopropyloxymethyl(methyl)amino]-1-(3,4-dichlorophenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171593445 |
| Molecular Formula | C19H22Cl2N2O3S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-[2-[cyclopropyloxymethyl(methyl)amino]-1-(3,4-dichlorophenyl)ethyl]benzenesulfonamide |
| SMILES | CN(COC1CC1)CC(NS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2O3S/c1-23(13-26-15-8-9-15)12-19(14-7-10-17(20)18(21)11-14)22-27(24,25)16-5-3-2-4-6-16/h2-7,10-11,15,19,22H,8-9,12-13H2,1H3 |
| InChIKey | PQHUZYWPMXYUIF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|