C27H34Cl2N2O — CID 17159389
1-benzyl-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]piperidin-4-amine;dihydrochloride (PubChem CID 17159389) has the molecular formula C27H34Cl2N2O and a molecular weight of 473.49 g/mol. Its IUPAC name is 1-benzyl-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]piperidin-4-amine;dihydrochloride.
| Compound Name | 1-benzyl-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 17159389 |
| Molecular Formula | C27H34Cl2N2O |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-benzyl-N-[[3-[(4-methylphenyl)methoxy]phenyl]methyl]piperidin-4-amine;dihydrochloride |
| SMILES | Cc1ccc(COc2cccc(CNC3CCN(Cc4ccccc4)CC3)c2)cc1.Cl.Cl |
| InChI | InChI=1S/C27H32N2O.2ClH/c1-22-10-12-24(13-11-22)21-30-27-9-5-8-25(18-27)19-28-26-14-16-29(17-15-26)20-23-6-3-2-4-7-23;;/h2-13,18,26,28H,14-17,19-21H2,1H3;2*1H |
| InChIKey | FDOWBWYBDDNZGO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |