About N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide
N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide (PubChem CID 171594071) has the molecular formula C17H31F2NO3
and a molecular weight of 335.44 g/mol. Its IUPAC name is N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide |
| PubChem CID | 171594071 |
| Molecular Formula | C17H31F2NO3 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(C(C)OCC1CCC(F)(F)CC1)C(C)(C)O |
| InChI | InChI=1S/C17H31F2NO3/c1-11(2)15(21)20-14(16(4,5)22)12(3)23-10-13-6-8-17(18,19)9-7-13/h11-14,22H,6-10H2,1-5H3,(H,20,21) |
| InChIKey | RZNNNSDPGYVAPJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide?
The IUPAC name of N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide (CID 171594071) is N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide.
What is the SMILES notation for N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide?
The canonical SMILES for N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide is CC(C)C(=O)NC(C(C)OCC1CCC(F)(F)CC1)C(C)(C)O.
What is the InChIKey of N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide?
The InChIKey is RZNNNSDPGYVAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31F2NO3/c1-11(2)15(21)20-14(16(4,5)22)12(3)23-10-13-6-8-17(18,19)9-7-13/h11-14,22H,6-10H2,1-5H3,(H,20,21).
What are the key properties of N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide?
N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide has a molecular weight of 335.44 g/mol, XLogP of 3.13, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(4,4-difluorocyclohexyl)methoxy]-2-hydroxy-2-methylpentan-3-yl]-2-methylpropanamide is sourced from PubChem (CID 171594071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).