C23H31FN2O2 — CID 171594380
(3S)-2-(1-adamantylmethyl)-3-ethyl-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 171594380) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is (3S)-2-(1-adamantylmethyl)-3-ethyl-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | (3S)-2-(1-adamantylmethyl)-3-ethyl-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 171594380 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (3S)-2-(1-adamantylmethyl)-3-ethyl-5-fluoro-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | CC[C@H]1Cc2c(F)cc(C(=O)NO)cc2CN1CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31FN2O2/c1-2-19-8-20-18(6-17(7-21(20)24)22(27)25-28)12-26(19)13-23-9-14-3-15(10-23)5-16(4-14)11-23/h6-7,14-16,19,28H,2-5,8-13H2,1H3,(H,25,27)/t14?,15?,16?,19-,23?/m0/s1 |
| InChIKey | DVOGFKAREBHXFR-HAVBXNNZSA-N |
| XLogP | 4.30 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|