C20H20ClN5 — CID 171595326
(1S)-1-(3-indazol-1-yl-2-pyridinyl)-2-(6-methyl-2-pyridinyl)ethanamine;hydrochloride (PubChem CID 171595326) has the molecular formula C20H20ClN5 and a molecular weight of 365.87 g/mol. Its IUPAC name is (1S)-1-(3-indazol-1-yl-2-pyridinyl)-2-(6-methyl-2-pyridinyl)ethanamine;hydrochloride.
| Compound Name | (1S)-1-(3-indazol-1-yl-2-pyridinyl)-2-(6-methyl-2-pyridinyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171595326 |
| Molecular Formula | C20H20ClN5 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (1S)-1-(3-indazol-1-yl-2-pyridinyl)-2-(6-methyl-2-pyridinyl)ethanamine;hydrochloride |
| SMILES | Cc1cccc(C[C@H](N)c2ncccc2-n2ncc3ccccc32)n1.Cl |
| InChI | InChI=1S/C20H19N5.ClH/c1-14-6-4-8-16(24-14)12-17(21)20-19(10-5-11-22-20)25-18-9-3-2-7-15(18)13-23-25;/h2-11,13,17H,12,21H2,1H3;1H/t17-;/m0./s1 |
| InChIKey | FHOVOIDGPFBRKL-LMOVPXPDSA-N |
| XLogP | 3.79 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |