C16H27F6NO2 — CID 171595445
4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 171595445) has the molecular formula C16H27F6NO2 and a molecular weight of 379.39 g/mol. Its IUPAC name is 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 171595445 |
| Molecular Formula | C16H27F6NO2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)butoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(OCCCCOC(C(F)(F)F)C(F)(F)F)CC(C)(C)N1 |
| InChI | InChI=1S/C16H27F6NO2/c1-13(2)9-11(10-14(3,4)23-13)24-7-5-6-8-25-12(15(17,18)19)16(20,21)22/h11-12,23H,5-10H2,1-4H3 |
| InChIKey | YHWCESHTMVKSPY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|