C51H31N3OS — CID 171597450
2-[8-[4-(3-dibenzothiophen-3-ylphenyl)phenyl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 171597450) has the molecular formula C51H31N3OS and a molecular weight of 733.90 g/mol. Its IUPAC name is 2-[8-[4-(3-dibenzothiophen-3-ylphenyl)phenyl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[8-[4-(3-dibenzothiophen-3-ylphenyl)phenyl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171597450 |
| Molecular Formula | C51H31N3OS |
| Molecular Weight | 733.90 g/mol |
| Exact Mass | 733.22 |
| IUPAC Name | 2-[8-[4-(3-dibenzothiophen-3-ylphenyl)phenyl]dibenzofuran-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccc(-c5ccc(-c6cccc(-c7ccc8c(c7)sc7ccccc78)c6)cc5)cc34)n2)cc1 |
| InChI | InChI=1S/C51H31N3OS/c1-3-10-34(11-4-1)49-52-50(35-12-5-2-6-13-35)54-51(53-49)40-23-25-41-44-29-38(24-27-45(44)55-46(41)30-40)33-20-18-32(19-21-33)36-14-9-15-37(28-36)39-22-26-43-42-16-7-8-17-47(42)56-48(43)31-39/h1-31H |
| InChIKey | LDVHLSGMNDAJOZ-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.90 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |