C24H34ClFN8O2Si — CID 171597591
1-[4-[[3-chloro-4-(ethylamino)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]-7-fluoroindazol-1-yl]-2-methylpropan-2-ol (PubChem CID 171597591) has the molecular formula C24H34ClFN8O2Si and a molecular weight of 549.13 g/mol. Its IUPAC name is 1-[4-[[3-chloro-4-(ethylamino)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]-7-fluoroindazol-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-[[3-chloro-4-(ethylamino)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]-7-fluoroindazol-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 171597591 |
| Molecular Formula | C24H34ClFN8O2Si |
| Molecular Weight | 549.13 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 1-[4-[[3-chloro-4-(ethylamino)-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-6-yl]amino]-7-fluoroindazol-1-yl]-2-methylpropan-2-ol |
| SMILES | CCNc1nc(Nc2ccc(F)c3c2cnn3CC(C)(C)O)nc2c1c(Cl)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H34ClFN8O2Si/c1-7-27-21-18-20(25)32-34(14-36-10-11-37(4,5)6)22(18)31-23(30-21)29-17-9-8-16(26)19-15(17)12-28-33(19)13-24(2,3)35/h8-9,12,35H,7,10-11,13-14H2,1-6H3,(H2,27,29,30,31) |
| InChIKey | QBTDKMHOWTUDFD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.13 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|