About 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one
5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one (PubChem CID 171601557) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one |
| PubChem CID | 171601557 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one |
| SMILES | C=Cc1cccc2c1C(=O)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C15H16O3/c1-2-11-7-6-8-12-13(11)14(16)18-15(17-12)9-4-3-5-10-15/h2,6-8H,1,3-5,9-10H2 |
| InChIKey | FBZQUEWQALDQOC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one?
The IUPAC name of 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one (CID 171601557) is 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one.
What is the SMILES notation for 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one?
The canonical SMILES for 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one is C=Cc1cccc2c1C(=O)OC1(CCCCC1)O2.
What is the InChIKey of 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one?
The InChIKey is FBZQUEWQALDQOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O3/c1-2-11-7-6-8-12-13(11)14(16)18-15(17-12)9-4-3-5-10-15/h2,6-8H,1,3-5,9-10H2.
What are the key properties of 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one?
5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one has a molecular weight of 244.29 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylspiro[1,3-benzodioxine-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 171601557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).