C13H23N3O3 — CID 171601787
tert-butyl N-[(2S)-2-hydroxypropyl]-N-[(2-methylpyrazol-3-yl)methyl]carbamate (PubChem CID 171601787) has the molecular formula C13H23N3O3 and a molecular weight of 269.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-hydroxypropyl]-N-[(2-methylpyrazol-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-hydroxypropyl]-N-[(2-methylpyrazol-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 171601787 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | tert-butyl N-[(2S)-2-hydroxypropyl]-N-[(2-methylpyrazol-3-yl)methyl]carbamate |
| SMILES | C[C@H](O)CN(Cc1ccnn1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23N3O3/c1-10(17)8-16(12(18)19-13(2,3)4)9-11-6-7-14-15(11)5/h6-7,10,17H,8-9H2,1-5H3/t10-/m0/s1 |
| InChIKey | CQDDDBHSUBKDRX-JTQLQIEISA-N |
| XLogP | 1.54 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |