C61H50N2O — CID 171603841
4-[3-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-dibenzofuran-4-yl-2-phenylpyrimidine (PubChem CID 171603841) has the molecular formula C61H50N2O and a molecular weight of 827.08 g/mol. Its IUPAC name is 4-[3-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-dibenzofuran-4-yl-2-phenylpyrimidine.
| Compound Name | 4-[3-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-dibenzofuran-4-yl-2-phenylpyrimidine |
|---|---|
| PubChem CID | 171603841 |
| Molecular Formula | C61H50N2O |
| Molecular Weight | 827.08 g/mol |
| Exact Mass | 826.39 |
| IUPAC Name | 4-[3-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-dibenzofuran-4-yl-2-phenylpyrimidine |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccccc3-c3ccc(-c4cccc(-c5cc(-c6cccc7c6oc6ccccc67)nc(-c6ccccc6)n5)c4)cc32)cc1 |
| InChI | InChI=1S/C61H50N2O/c1-59(2,3)43-27-31-45(32-28-43)61(46-33-29-44(30-34-46)60(4,5)6)52-24-12-10-20-47(52)48-35-26-41(37-53(48)61)40-18-14-19-42(36-40)54-38-55(63-58(62-54)39-16-8-7-9-17-39)51-23-15-22-50-49-21-11-13-25-56(49)64-57(50)51/h7-38H,1-6H3 |
| InChIKey | PPVPWBFUQYCSHU-UHFFFAOYSA-N |
| XLogP | 16.00 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.08 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |