C16H19FN5O5+ — CID 171606873
bis(carboxymethyl)-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]-methylazanium (PubChem CID 171606873) has the molecular formula C16H19FN5O5+ and a molecular weight of 380.36 g/mol. Its IUPAC name is bis(carboxymethyl)-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]-methylazanium.
| Compound Name | bis(carboxymethyl)-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]-methylazanium |
|---|---|
| PubChem CID | 171606873 |
| Molecular Formula | C16H19FN5O5+ |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | bis(carboxymethyl)-[[2-(2-fluoroethoxy)-4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]-methylazanium |
| SMILES | C[N+](CC(=O)O)(CC(=O)O)Cc1ccc(-c2nncnn2)cc1OCCF |
| InChI | InChI=1S/C16H18FN5O5/c1-22(8-14(23)24,9-15(25)26)7-12-3-2-11(6-13(12)27-5-4-17)16-20-18-10-19-21-16/h2-3,6,10H,4-5,7-9H2,1H3,(H-,23,24,25,26)/p+1 |
| InChIKey | MCOWEFUGQOXQDP-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 135.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|