About N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide
N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide (PubChem CID 171607633) has the molecular formula C10H17NO3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide |
| PubChem CID | 171607633 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide |
| SMILES | CNS(=O)(=O)C1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C10H17NO3S/c1-11-15(12,13)6-4-7-8(5-6)10-3-2-9(7)14-10/h6-11H,2-5H2,1H3 |
| InChIKey | AXLORJURUKFVTB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide?
The IUPAC name of N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide (CID 171607633) is N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide.
What is the SMILES notation for N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide?
The canonical SMILES for N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide is CNS(=O)(=O)C1CC2C3CCC(O3)C2C1.
What is the InChIKey of N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide?
The InChIKey is AXLORJURUKFVTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3S/c1-11-15(12,13)6-4-7-8(5-6)10-3-2-9(7)14-10/h6-11H,2-5H2,1H3.
What are the key properties of N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide?
N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide has a molecular weight of 231.32 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-10-oxatricyclo[5.2.1.02,6]decane-4-sulfonamide is sourced from PubChem (CID 171607633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).