About N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide
N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide (PubChem CID 171608683) has the molecular formula C12H21F2NO
and a molecular weight of 233.30 g/mol. Its IUPAC name is N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide.
Molecular Properties
| Compound Name | N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide |
| PubChem CID | 171608683 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide |
| SMILES | CC(F)(F)C(=O)NC(CC1CC1)C(C)(C)C |
| InChI | InChI=1S/C12H21F2NO/c1-11(2,3)9(7-8-5-6-8)15-10(16)12(4,13)14/h8-9H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | JNCGPTAUQPHSOW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
The IUPAC name of N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide (CID 171608683) is N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide.
What is the SMILES notation for N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
The canonical SMILES for N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide is CC(F)(F)C(=O)NC(CC1CC1)C(C)(C)C.
What is the InChIKey of N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
The InChIKey is JNCGPTAUQPHSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO/c1-11(2,3)9(7-8-5-6-8)15-10(16)12(4,13)14/h8-9H,5-7H2,1-4H3,(H,15,16).
What are the key properties of N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide?
N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide has a molecular weight of 233.30 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropyl-3,3-dimethylbutan-2-yl)-2,2-difluoropropanamide is sourced from PubChem (CID 171608683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).