About (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate
(4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 171611984) has the molecular formula C11H12N2O6
and a molecular weight of 268.22 g/mol. Its IUPAC name is (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate.
Molecular Properties
| Compound Name | (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate |
| PubChem CID | 171611984 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | O=CCCC(=O)NOC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H12N2O6/c14-7-1-2-8(15)12-19-11(18)5-6-13-9(16)3-4-10(13)17/h3-4,7H,1-2,5-6H2,(H,12,15) |
| InChIKey | IATDDUOKVQLHPC-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate?
The IUPAC name of (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate (CID 171611984) is (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate.
What is the SMILES notation for (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate?
The canonical SMILES for (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate is O=CCCC(=O)NOC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate?
The InChIKey is IATDDUOKVQLHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O6/c14-7-1-2-8(15)12-19-11(18)5-6-13-9(16)3-4-10(13)17/h3-4,7H,1-2,5-6H2,(H,12,15).
What are the key properties of (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate?
(4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate has a molecular weight of 268.22 g/mol, XLogP of -1.14, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxobutanoylamino) 3-(2,5-dioxopyrrol-1-yl)propanoate is sourced from PubChem (CID 171611984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).