C22H27BF2O4 — CID 171613464
ethyl 2-fluoro-4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate (PubChem CID 171613464) has the molecular formula C22H27BF2O4 and a molecular weight of 404.26 g/mol. Its IUPAC name is ethyl 2-fluoro-4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate.
| Compound Name | ethyl 2-fluoro-4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
|---|---|
| PubChem CID | 171613464 |
| Molecular Formula | C22H27BF2O4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | ethyl 2-fluoro-4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
| SMILES | CCOC(=O)C(F)CCc1c(F)ccc2cccc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C22H27BF2O4/c1-6-27-20(26)18(25)13-11-15-17(24)12-10-14-8-7-9-16(19(14)15)23-28-21(2,3)22(4,5)29-23/h7-10,12,18H,6,11,13H2,1-5H3 |
| InChIKey | XMDHKCNAFLVMSE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|