C24H32BFO4 — CID 171613479
tert-butyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate (PubChem CID 171613479) has the molecular formula C24H32BFO4 and a molecular weight of 414.33 g/mol. Its IUPAC name is tert-butyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate.
| Compound Name | tert-butyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
|---|---|
| PubChem CID | 171613479 |
| Molecular Formula | C24H32BFO4 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | tert-butyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCc1c(F)ccc2cccc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C24H32BFO4/c1-22(2,3)28-20(27)13-9-11-17-19(26)15-14-16-10-8-12-18(21(16)17)25-29-23(4,5)24(6,7)30-25/h8,10,12,14-15H,9,11,13H2,1-7H3 |
| InChIKey | KMWGPEBEBAFQBB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|