C21H27ClFN5O4 — CID 171613503
(6S)-4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxy)-7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-6-ol (PubChem CID 171613503) has the molecular formula C21H27ClFN5O4 and a molecular weight of 467.93 g/mol. Its IUPAC name is (6S)-4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxy)-7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-6-ol.
| Compound Name | (6S)-4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxy)-7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 171613503 |
| Molecular Formula | C21H27ClFN5O4 |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (6S)-4-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-6-ylmethoxy)-7-chloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl]-6-methyl-1,4-oxazepan-6-ol |
| SMILES | C[C@@]1(O)COCCN(c2nc(OCC3CCC4COCCN43)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C21H27ClFN5O4/c1-21(29)11-27(4-6-31-12-21)19-15-8-24-18(22)16(23)17(15)25-20(26-19)32-10-14-3-2-13-9-30-7-5-28(13)14/h8,13-14,29H,2-7,9-12H2,1H3/t13?,14?,21-/m0/s1 |
| InChIKey | SUOWUMJGFZYIRM-ABNGFUMUSA-N |
| XLogP | 1.65 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|