C24H28BFO4 — CID 171613633
tert-butyl 2-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]but-3-ynoate (PubChem CID 171613633) has the molecular formula C24H28BFO4 and a molecular weight of 410.29 g/mol. Its IUPAC name is tert-butyl 2-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]but-3-ynoate.
| Compound Name | tert-butyl 2-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]but-3-ynoate |
|---|---|
| PubChem CID | 171613633 |
| Molecular Formula | C24H28BFO4 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | tert-butyl 2-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]but-3-ynoate |
| SMILES | C#CC(C(=O)OC(C)(C)C)c1c(F)ccc2cccc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C24H28BFO4/c1-9-16(21(27)28-22(2,3)4)20-18(26)14-13-15-11-10-12-17(19(15)20)25-29-23(5,6)24(7,8)30-25/h1,10-14,16H,2-8H3 |
| InChIKey | QMJAUQILDCYCIB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|